C12H21NO — CID 169112307
4-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-1-methylpiperidine (PubChem CID 169112307) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-1-methylpiperidine.
| Compound Name | 4-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-1-methylpiperidine |
|---|---|
| PubChem CID | 169112307 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 4-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-1-methylpiperidine |
| SMILES | C/C=C\C(=C/C)OC1CCN(C)CC1 |
| InChI | InChI=1S/C12H21NO/c1-4-6-11(5-2)14-12-7-9-13(3)10-8-12/h4-6,12H,7-10H2,1-3H3/b6-4-,11-5+ |
| InChIKey | NDUPQPIHBXBBSV-NQTKGXIKSA-N |
| XLogP | 2.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|