C23H32N4O3S — CID 111949747
2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-ethylguanidine (PubChem CID 111949747) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is 2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-ethylguanidine.
| Compound Name | 2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111949747 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 2-[[2-(tert-butylsulfamoyl)phenyl]methyl]-1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccccc1S(=O)(=O)NC(C)(C)C)NCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C23H32N4O3S/c1-5-24-22(26-16-19-14-17-10-6-8-12-20(17)30-19)25-15-18-11-7-9-13-21(18)31(28,29)27-23(2,3)4/h6-13,19,27H,5,14-16H2,1-4H3,(H2,24,25,26) |
| InChIKey | OILVUUZEBHLADY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|