C9H14O5 — CID 11195019
(4S,5S,6R)-4,6-dihydroxy-5-(methoxymethoxy)-6-methylcyclohex-2-en-1-one (PubChem CID 11195019) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is (4S,5S,6R)-4,6-dihydroxy-5-(methoxymethoxy)-6-methylcyclohex-2-en-1-one.
| Compound Name | (4S,5S,6R)-4,6-dihydroxy-5-(methoxymethoxy)-6-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11195019 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (4S,5S,6R)-4,6-dihydroxy-5-(methoxymethoxy)-6-methylcyclohex-2-en-1-one |
| SMILES | COCO[C@H]1[C@@H](O)C=CC(=O)[C@]1(C)O |
| InChI | InChI=1S/C9H14O5/c1-9(12)7(11)4-3-6(10)8(9)14-5-13-2/h3-4,6,8,10,12H,5H2,1-2H3/t6-,8-,9-/m0/s1 |
| InChIKey | LRWFCCKIWVDIBW-XVYDVKMFSA-N |
| XLogP | -0.77 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|