C24H30N4O2 — CID 111950271
N-[3-[[[(2,3-dihydro-1-benzofuran-2-ylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide (PubChem CID 111950271) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[3-[[[(2,3-dihydro-1-benzofuran-2-ylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[[(2,3-dihydro-1-benzofuran-2-ylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 111950271 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-[3-[[[(2,3-dihydro-1-benzofuran-2-ylmethylamino)-(ethylamino)methylidene]amino]methyl]phenyl]cyclobutanecarboxamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCC2)c1)NCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C24H30N4O2/c1-2-25-24(27-16-21-14-19-8-3-4-12-22(19)30-21)26-15-17-7-5-11-20(13-17)28-23(29)18-9-6-10-18/h3-5,7-8,11-13,18,21H,2,6,9-10,14-16H2,1H3,(H,28,29)(H2,25,26,27) |
| InChIKey | IEQPBLXUVWLDIC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|