C20H31FN6 — CID 111952035
1-ethyl-3-[3-(2-fluoro-N-methylanilino)propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 111952035) has the molecular formula C20H31FN6 and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-ethyl-3-[3-(2-fluoro-N-methylanilino)propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(2-fluoro-N-methylanilino)propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111952035 |
| Molecular Formula | C20H31FN6 |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 1-ethyl-3-[3-(2-fluoro-N-methylanilino)propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(C)c1C)NCCCN(C)c1ccccc1F |
| InChI | InChI=1S/C20H31FN6/c1-6-22-20(24-14-17-15(2)25-27(5)16(17)3)23-12-9-13-26(4)19-11-8-7-10-18(19)21/h7-8,10-11H,6,9,12-14H2,1-5H3,(H2,22,23,24) |
| InChIKey | CUPYDMFTJMFXLB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|