C16H32N6O2S — CID 111951593
1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 111951593) has the molecular formula C16H32N6O2S and a molecular weight of 372.54 g/mol. Its IUPAC name is 1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111951593 |
| Molecular Formula | C16H32N6O2S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 1-ethyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1c(C)nn(C)c1C)NCCCN(C)S(=O)(=O)CC |
| InChI | InChI=1S/C16H32N6O2S/c1-7-17-16(18-10-9-11-21(5)25(23,24)8-2)19-12-15-13(3)20-22(6)14(15)4/h7-12H2,1-6H3,(H2,17,18,19) |
| InChIKey | DBFCEDVPSCIBEE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|