C14H29IN6O2S — CID 111952298
1-ethyl-3-[3-(methanesulfonamido)propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111952298) has the molecular formula C14H29IN6O2S and a molecular weight of 472.40 g/mol. Its IUPAC name is 1-ethyl-3-[3-(methanesulfonamido)propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(methanesulfonamido)propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111952298 |
| Molecular Formula | C14H29IN6O2S |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 1-ethyl-3-[3-(methanesulfonamido)propyl]-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(C)nn(C)c1C)NCCCNS(C)(=O)=O.I |
| InChI | InChI=1S/C14H28N6O2S.HI/c1-6-15-14(16-8-7-9-18-23(5,21)22)17-10-13-11(2)19-20(4)12(13)3;/h18H,6-10H2,1-5H3,(H2,15,16,17);1H |
| InChIKey | PSXAOSLNIJROLH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|