C21H35IN6 — CID 111952426
1-[3-[benzyl(methyl)amino]propyl]-3-ethyl-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111952426) has the molecular formula C21H35IN6 and a molecular weight of 498.46 g/mol. Its IUPAC name is 1-[3-[benzyl(methyl)amino]propyl]-3-ethyl-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-[benzyl(methyl)amino]propyl]-3-ethyl-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111952426 |
| Molecular Formula | C21H35IN6 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 1-[3-[benzyl(methyl)amino]propyl]-3-ethyl-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(C)nn(C)c1C)NCCCN(C)Cc1ccccc1.I |
| InChI | InChI=1S/C21H34N6.HI/c1-6-22-21(24-15-20-17(2)25-27(5)18(20)3)23-13-10-14-26(4)16-19-11-8-7-9-12-19;/h7-9,11-12H,6,10,13-16H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | GEWDMSCZLTUFIU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|