C18H27N5O2S — CID 111955317
1-(3-benzylsulfonylpropyl)-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine (PubChem CID 111955317) has the molecular formula C18H27N5O2S and a molecular weight of 377.51 g/mol. Its IUPAC name is 1-(3-benzylsulfonylpropyl)-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-(3-benzylsulfonylpropyl)-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111955317 |
| Molecular Formula | C18H27N5O2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-(3-benzylsulfonylpropyl)-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H27N5O2S/c1-3-19-18(21-14-17-10-12-22-23(17)2)20-11-7-13-26(24,25)15-16-8-5-4-6-9-16/h4-6,8-10,12H,3,7,11,13-15H2,1-2H3,(H2,19,20,21) |
| InChIKey | SFGZRVHGCYIPGC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|