C15H26N4OS — CID 111957381
2-[[ethylamino-[(5-ethylthiophen-2-yl)methylamino]methylidene]amino]-N-propylacetamide (PubChem CID 111957381) has the molecular formula C15H26N4OS and a molecular weight of 310.47 g/mol. Its IUPAC name is 2-[[ethylamino-[(5-ethylthiophen-2-yl)methylamino]methylidene]amino]-N-propylacetamide.
| Compound Name | 2-[[ethylamino-[(5-ethylthiophen-2-yl)methylamino]methylidene]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 111957381 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-[[ethylamino-[(5-ethylthiophen-2-yl)methylamino]methylidene]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)C/N=C(\NCC)NCc1ccc(CC)s1 |
| InChI | InChI=1S/C15H26N4OS/c1-4-9-17-14(20)11-19-15(16-6-3)18-10-13-8-7-12(5-2)21-13/h7-8H,4-6,9-11H2,1-3H3,(H,17,20)(H2,16,18,19) |
| InChIKey | ZUOKRPPCLWUPSX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|