C20H33FN4O — CID 111959631
4-ethoxy-N-ethyl-N'-[3-(2-fluoro-N-methylanilino)propyl]piperidine-1-carboximidamide (PubChem CID 111959631) has the molecular formula C20H33FN4O and a molecular weight of 364.51 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-N'-[3-(2-fluoro-N-methylanilino)propyl]piperidine-1-carboximidamide.
| Compound Name | 4-ethoxy-N-ethyl-N'-[3-(2-fluoro-N-methylanilino)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111959631 |
| Molecular Formula | C20H33FN4O |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 4-ethoxy-N-ethyl-N'-[3-(2-fluoro-N-methylanilino)propyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN(C)c1ccccc1F)N1CCC(OCC)CC1 |
| InChI | InChI=1S/C20H33FN4O/c1-4-22-20(25-15-11-17(12-16-25)26-5-2)23-13-8-14-24(3)19-10-7-6-9-18(19)21/h6-7,9-10,17H,4-5,8,11-16H2,1-3H3,(H,22,23) |
| InChIKey | YMMGZXNFOLKNQZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|