C14H16O2S — CID 11195996
(2Z)-6-(benzenesulfinyl)octa-2,6,7-trien-1-ol (PubChem CID 11195996) has the molecular formula C14H16O2S and a molecular weight of 248.35 g/mol. Its IUPAC name is (2Z)-6-(benzenesulfinyl)octa-2,6,7-trien-1-ol.
| Compound Name | (2Z)-6-(benzenesulfinyl)octa-2,6,7-trien-1-ol |
|---|---|
| PubChem CID | 11195996 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | (2Z)-6-(benzenesulfinyl)octa-2,6,7-trien-1-ol |
| SMILES | C=C=C(CC/C=C\CO)S(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16O2S/c1-2-13(9-7-4-8-12-15)17(16)14-10-5-3-6-11-14/h3-6,8,10-11,15H,1,7,9,12H2/b8-4- |
| InChIKey | XSKWKFAUJZAOPH-YWEYNIOJSA-N |
| XLogP | 2.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|