C12H20O6 — CID 11196244
(3R,5S,6S)-3-[(E,1R)-1-hydroxybut-2-enyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one (PubChem CID 11196244) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is (3R,5S,6S)-3-[(E,1R)-1-hydroxybut-2-enyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one.
| Compound Name | (3R,5S,6S)-3-[(E,1R)-1-hydroxybut-2-enyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 11196244 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (3R,5S,6S)-3-[(E,1R)-1-hydroxybut-2-enyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one |
| SMILES | C/C=C/[C@@H](O)[C@H]1O[C@](C)(OC)[C@@](C)(OC)OC1=O |
| InChI | InChI=1S/C12H20O6/c1-6-7-8(13)9-10(14)18-12(3,16-5)11(2,15-4)17-9/h6-9,13H,1-5H3/b7-6+/t8-,9-,11+,12+/m1/s1 |
| InChIKey | BXJWCWZWMBZBFO-DHHUEORBSA-N |
| XLogP | 0.59 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|