C15H15NO2Si — CID 11196481
trimethyl-[(E)-6-(4-nitrophenyl)hex-1-en-3,5-diynyl]silane (PubChem CID 11196481) has the molecular formula C15H15NO2Si and a molecular weight of 269.38 g/mol. Its IUPAC name is trimethyl-[(E)-6-(4-nitrophenyl)hex-1-en-3,5-diynyl]silane.
| Compound Name | trimethyl-[(E)-6-(4-nitrophenyl)hex-1-en-3,5-diynyl]silane |
|---|---|
| PubChem CID | 11196481 |
| Molecular Formula | C15H15NO2Si |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | trimethyl-[(E)-6-(4-nitrophenyl)hex-1-en-3,5-diynyl]silane |
| SMILES | C[Si](C)(C)/C=C/C#CC#Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H15NO2Si/c1-19(2,3)13-7-5-4-6-8-14-9-11-15(12-10-14)16(17)18/h7,9-13H,1-3H3/b13-7+ |
| InChIKey | GYZJBGWYTDHXPW-NTUHNPAUSA-N |
| XLogP | 3.38 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|