C13H17NO3Si — CID 101241776
trimethyl-[(E)-2-[(2R,3R)-3-(4-nitrophenyl)oxiran-2-yl]ethenyl]silane (PubChem CID 101241776) has the molecular formula C13H17NO3Si and a molecular weight of 263.37 g/mol. Its IUPAC name is trimethyl-[(E)-2-[(2R,3R)-3-(4-nitrophenyl)oxiran-2-yl]ethenyl]silane.
| Compound Name | trimethyl-[(E)-2-[(2R,3R)-3-(4-nitrophenyl)oxiran-2-yl]ethenyl]silane |
|---|---|
| PubChem CID | 101241776 |
| Molecular Formula | C13H17NO3Si |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | trimethyl-[(E)-2-[(2R,3R)-3-(4-nitrophenyl)oxiran-2-yl]ethenyl]silane |
| SMILES | C[Si](C)(C)/C=C/[C@H]1O[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H17NO3Si/c1-18(2,3)9-8-12-13(17-12)10-4-6-11(7-5-10)14(15)16/h4-9,12-13H,1-3H3/b9-8+/t12-,13-/m1/s1 |
| InChIKey | XKYJSWHCHBTTJN-RYYBZQDPSA-N |
| XLogP | 3.47 |
| TPSA | 55.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|