C15H11NSe — CID 11196856
2,4-diphenyl-1,3-selenazole (PubChem CID 11196856) has the molecular formula C15H11NSe and a molecular weight of 284.22 g/mol. Its IUPAC name is 2,4-diphenyl-1,3-selenazole.
| Compound Name | 2,4-diphenyl-1,3-selenazole |
|---|---|
| PubChem CID | 11196856 |
| Molecular Formula | C15H11NSe |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 2,4-diphenyl-1,3-selenazole |
| SMILES | c1ccc(-c2c[se]c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C15H11NSe/c1-3-7-12(8-4-1)14-11-17-15(16-14)13-9-5-2-6-10-13/h1-11H |
| InChIKey | SLHAKGDWLDLSME-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|