C20H23IN4 — CID 111968660
2-methyl-1-[(4-methylphenyl)methyl]-3-(quinolin-4-ylmethyl)guanidine;hydroiodide (PubChem CID 111968660) has the molecular formula C20H23IN4 and a molecular weight of 446.34 g/mol. Its IUPAC name is 2-methyl-1-[(4-methylphenyl)methyl]-3-(quinolin-4-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-methylphenyl)methyl]-3-(quinolin-4-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111968660 |
| Molecular Formula | C20H23IN4 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 2-methyl-1-[(4-methylphenyl)methyl]-3-(quinolin-4-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C)cc1)NCc1ccnc2ccccc12.I |
| InChI | InChI=1S/C20H22N4.HI/c1-15-7-9-16(10-8-15)13-23-20(21-2)24-14-17-11-12-22-19-6-4-3-5-18(17)19;/h3-12H,13-14H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | MEJRDMYBUNWZIV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|