C19H20BrIN4 — CID 111978589
1-[(4-bromophenyl)methyl]-2-methyl-3-(quinolin-4-ylmethyl)guanidine;hydroiodide (PubChem CID 111978589) has the molecular formula C19H20BrIN4 and a molecular weight of 511.21 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-2-methyl-3-(quinolin-4-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(4-bromophenyl)methyl]-2-methyl-3-(quinolin-4-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111978589 |
| Molecular Formula | C19H20BrIN4 |
| Molecular Weight | 511.21 g/mol |
| Exact Mass | 509.99 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-2-methyl-3-(quinolin-4-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Br)cc1)NCc1ccnc2ccccc12.I |
| InChI | InChI=1S/C19H19BrN4.HI/c1-21-19(23-12-14-6-8-16(20)9-7-14)24-13-15-10-11-22-18-5-3-2-4-17(15)18;/h2-11H,12-13H2,1H3,(H2,21,23,24);1H |
| InChIKey | OCVUITWZWZARJQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.21 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|