C15H26N4O2 — CID 111969725
3-(2-tert-butylpyrimidin-5-yl)-1-(2-hydroxypropyl)-1-propan-2-ylurea (PubChem CID 111969725) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-(2-tert-butylpyrimidin-5-yl)-1-(2-hydroxypropyl)-1-propan-2-ylurea.
| Compound Name | 3-(2-tert-butylpyrimidin-5-yl)-1-(2-hydroxypropyl)-1-propan-2-ylurea |
|---|---|
| PubChem CID | 111969725 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 3-(2-tert-butylpyrimidin-5-yl)-1-(2-hydroxypropyl)-1-propan-2-ylurea |
| SMILES | CC(O)CN(C(=O)Nc1cnc(C(C)(C)C)nc1)C(C)C |
| InChI | InChI=1S/C15H26N4O2/c1-10(2)19(9-11(3)20)14(21)18-12-7-16-13(17-8-12)15(4,5)6/h7-8,10-11,20H,9H2,1-6H3,(H,18,21) |
| InChIKey | QGONJFWSTDTYOH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |