C14H22N2O3S — CID 111969781
1-(2-hydroxypropyl)-3-(4-methylsulfinylphenyl)-1-propan-2-ylurea (PubChem CID 111969781) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 1-(2-hydroxypropyl)-3-(4-methylsulfinylphenyl)-1-propan-2-ylurea.
| Compound Name | 1-(2-hydroxypropyl)-3-(4-methylsulfinylphenyl)-1-propan-2-ylurea |
|---|---|
| PubChem CID | 111969781 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-(2-hydroxypropyl)-3-(4-methylsulfinylphenyl)-1-propan-2-ylurea |
| SMILES | CC(O)CN(C(=O)Nc1ccc(S(C)=O)cc1)C(C)C |
| InChI | InChI=1S/C14H22N2O3S/c1-10(2)16(9-11(3)17)14(18)15-12-5-7-13(8-6-12)20(4)19/h5-8,10-11,17H,9H2,1-4H3,(H,15,18) |
| InChIKey | YLOZLYWRGJMRRJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |