C17H28N2O2S — CID 111969892
N-[2-(dimethylamino)ethyl]-2-(1-hydroxycyclohexyl)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 111969892) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-(1-hydroxycyclohexyl)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-(1-hydroxycyclohexyl)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 111969892 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-(1-hydroxycyclohexyl)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CN(C)CCN(Cc1cccs1)C(=O)CC1(O)CCCCC1 |
| InChI | InChI=1S/C17H28N2O2S/c1-18(2)10-11-19(14-15-7-6-12-22-15)16(20)13-17(21)8-4-3-5-9-17/h6-7,12,21H,3-5,8-11,13-14H2,1-2H3 |
| InChIKey | CHRVRWMNPVZWCH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |