C20H25FN6 — CID 111972368
1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 111972368) has the molecular formula C20H25FN6 and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111972368 |
| Molecular Formula | C20H25FN6 |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCc1ccnc(N(C)C)c1 |
| InChI | InChI=1S/C20H25FN6/c1-22-20(26-12-14-6-8-23-19(10-14)27(2)3)24-9-7-15-13-25-18-5-4-16(21)11-17(15)18/h4-6,8,10-11,13,25H,7,9,12H2,1-3H3,(H2,22,24,26) |
| InChIKey | YZTWMZIYINVASQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|