C17H28F2N4O2S — CID 111981181
2-[2-(diethylsulfamoyl)ethyl]-1-[1-(2,4-difluorophenyl)ethyl]-3-ethylguanidine (PubChem CID 111981181) has the molecular formula C17H28F2N4O2S and a molecular weight of 390.50 g/mol. Its IUPAC name is 2-[2-(diethylsulfamoyl)ethyl]-1-[1-(2,4-difluorophenyl)ethyl]-3-ethylguanidine.
| Compound Name | 2-[2-(diethylsulfamoyl)ethyl]-1-[1-(2,4-difluorophenyl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111981181 |
| Molecular Formula | C17H28F2N4O2S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2-[2-(diethylsulfamoyl)ethyl]-1-[1-(2,4-difluorophenyl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCS(=O)(=O)N(CC)CC)NC(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H28F2N4O2S/c1-5-20-17(21-10-11-26(24,25)23(6-2)7-3)22-13(4)15-9-8-14(18)12-16(15)19/h8-9,12-13H,5-7,10-11H2,1-4H3,(H2,20,21,22) |
| InChIKey | QLVZAUJHDNCVOH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|