C26H30IN5O2 — CID 111981220
1-[[2-[[furan-2-ylmethyl(methyl)amino]methyl]phenyl]methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111981220) has the molecular formula C26H30IN5O2 and a molecular weight of 571.46 g/mol. Its IUPAC name is 1-[[2-[[furan-2-ylmethyl(methyl)amino]methyl]phenyl]methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[2-[[furan-2-ylmethyl(methyl)amino]methyl]phenyl]methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111981220 |
| Molecular Formula | C26H30IN5O2 |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | 1-[[2-[[furan-2-ylmethyl(methyl)amino]methyl]phenyl]methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1coc(-c2ccccc2)n1)NCc1ccccc1CN(C)Cc1ccco1.I |
| InChI | InChI=1S/C26H29N5O2.HI/c1-27-26(29-16-23-19-33-25(30-23)20-9-4-3-5-10-20)28-15-21-11-6-7-12-22(21)17-31(2)18-24-13-8-14-32-24;/h3-14,19H,15-18H2,1-2H3,(H2,27,28,29);1H |
| InChIKey | PSUXNBCOOUGBEZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|