C20H27IN4S — CID 111983954
1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide (PubChem CID 111983954) has the molecular formula C20H27IN4S and a molecular weight of 482.44 g/mol. Its IUPAC name is 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111983954 |
| Molecular Formula | C20H27IN4S |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 1-[3-(1H-indol-3-yl)propyl]-2-methyl-3-(2-thiophen-3-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1c[nH]c2ccccc12)NCC(C)c1ccsc1.I |
| InChI | InChI=1S/C20H26N4S.HI/c1-15(17-9-11-25-14-17)12-24-20(21-2)22-10-5-6-16-13-23-19-8-4-3-7-18(16)19;/h3-4,7-9,11,13-15,23H,5-6,10,12H2,1-2H3,(H2,21,22,24);1H |
| InChIKey | TYODWABLNOBNSX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|