C19H22Cl2N4O2 — CID 111984473
2-[3-[[[N-[1-(3,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide (PubChem CID 111984473) has the molecular formula C19H22Cl2N4O2 and a molecular weight of 409.32 g/mol. Its IUPAC name is 2-[3-[[[N-[1-(3,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[[N-[1-(3,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111984473 |
| Molecular Formula | C19H22Cl2N4O2 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2-[3-[[[N-[1-(3,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]acetamide |
| SMILES | C/N=C(\NCc1cccc(OCC(N)=O)c1)NC(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl2N4O2/c1-12(14-6-7-16(20)17(21)9-14)25-19(23-2)24-10-13-4-3-5-15(8-13)27-11-18(22)26/h3-9,12H,10-11H2,1-2H3,(H2,22,26)(H2,23,24,25) |
| InChIKey | RRNCSTARUQPCPH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|