C13H27N3 — CID 111986491
1-(2-ethylbutyl)-2-methyl-3-[(E)-pent-3-enyl]guanidine (PubChem CID 111986491) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-(2-ethylbutyl)-2-methyl-3-[(E)-pent-3-enyl]guanidine.
| Compound Name | 1-(2-ethylbutyl)-2-methyl-3-[(E)-pent-3-enyl]guanidine |
|---|---|
| PubChem CID | 111986491 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 1-(2-ethylbutyl)-2-methyl-3-[(E)-pent-3-enyl]guanidine |
| SMILES | C/C=C/CCN/C(=N\C)NCC(CC)CC |
| InChI | InChI=1S/C13H27N3/c1-5-8-9-10-15-13(14-4)16-11-12(6-2)7-3/h5,8,12H,6-7,9-11H2,1-4H3,(H2,14,15,16)/b8-5+ |
| InChIKey | AQLPJDOCRTXONN-VMPITWQZSA-N |
| XLogP | 2.55 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|