C11H19N5 — CID 176523951
1-(diaminomethylidene)-3-[2-(2-methylcyclohexa-2,4-dien-1-yl)ethyl]guanidine (PubChem CID 176523951) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-[2-(2-methylcyclohexa-2,4-dien-1-yl)ethyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-3-[2-(2-methylcyclohexa-2,4-dien-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 176523951 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1-(diaminomethylidene)-3-[2-(2-methylcyclohexa-2,4-dien-1-yl)ethyl]guanidine |
| SMILES | [H]/N=C(/N=C(N)N)NCCC1CC=CC=C1C |
| InChI | InChI=1S/C11H19N5/c1-8-4-2-3-5-9(8)6-7-15-11(14)16-10(12)13/h2-4,9H,5-7H2,1H3,(H6,12,13,14,15,16) |
| InChIKey | CLBORLUFEWXUES-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|