C18H31N3 — CID 146661126
N-(1-amino-2-ethenylpentyl)-N'-(2-cyclohexa-1,5-dien-1-ylbutyl)methanimidamide (PubChem CID 146661126) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is N-(1-amino-2-ethenylpentyl)-N'-(2-cyclohexa-1,5-dien-1-ylbutyl)methanimidamide.
| Compound Name | N-(1-amino-2-ethenylpentyl)-N'-(2-cyclohexa-1,5-dien-1-ylbutyl)methanimidamide |
|---|---|
| PubChem CID | 146661126 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | N-(1-amino-2-ethenylpentyl)-N'-(2-cyclohexa-1,5-dien-1-ylbutyl)methanimidamide |
| SMILES | C=CC(CCC)C(N)N/C=N/CC(CC)C1=CCCC=C1 |
| InChI | InChI=1S/C18H31N3/c1-4-10-15(5-2)18(19)21-14-20-13-16(6-3)17-11-8-7-9-12-17/h5,8,11-12,14-16,18H,2,4,6-7,9-10,13,19H2,1,3H3,(H,20,21) |
| InChIKey | KWHKNLJKVMNLGR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|