C13H26N2 — CID 123570444
N'-methyl-N-(2,4,7-trimethyloct-5-enyl)methanimidamide (PubChem CID 123570444) has the molecular formula C13H26N2 and a molecular weight of 210.37 g/mol. Its IUPAC name is N'-methyl-N-(2,4,7-trimethyloct-5-enyl)methanimidamide.
| Compound Name | N'-methyl-N-(2,4,7-trimethyloct-5-enyl)methanimidamide |
|---|---|
| PubChem CID | 123570444 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | N'-methyl-N-(2,4,7-trimethyloct-5-enyl)methanimidamide |
| SMILES | C/N=C/NCC(C)CC(C)C=CC(C)C |
| InChI | InChI=1S/C13H26N2/c1-11(2)6-7-12(3)8-13(4)9-15-10-14-5/h6-7,10-13H,8-9H2,1-5H3,(H,14,15) |
| InChIKey | YQFJDSLKCTYQPA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|