C16H27N3 — CID 163243760
N-[(Z)-4-(dimethylamino)-4-(2,6-dimethylcyclohexa-2,4-dien-1-yl)but-2-en-2-yl]-N'-methylmethanimidamide (PubChem CID 163243760) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is N-[(Z)-4-(dimethylamino)-4-(2,6-dimethylcyclohexa-2,4-dien-1-yl)but-2-en-2-yl]-N'-methylmethanimidamide.
| Compound Name | N-[(Z)-4-(dimethylamino)-4-(2,6-dimethylcyclohexa-2,4-dien-1-yl)but-2-en-2-yl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 163243760 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | N-[(Z)-4-(dimethylamino)-4-(2,6-dimethylcyclohexa-2,4-dien-1-yl)but-2-en-2-yl]-N'-methylmethanimidamide |
| SMILES | C/N=C/N/C(C)=C\C(C1C(C)=CC=CC1C)N(C)C |
| InChI | InChI=1S/C16H27N3/c1-12-8-7-9-13(2)16(12)15(19(5)6)10-14(3)18-11-17-4/h7-12,15-16H,1-6H3,(H,17,18)/b14-10- |
| InChIKey | SAUCMHLUWBZNTB-UVTDQMKNSA-N |
| XLogP | 2.84 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|