C19H32IN3O — CID 111987084
1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[(1-hydroxycyclopentyl)methyl]guanidine;hydroiodide (PubChem CID 111987084) has the molecular formula C19H32IN3O and a molecular weight of 445.39 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[(1-hydroxycyclopentyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[(1-hydroxycyclopentyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111987084 |
| Molecular Formula | C19H32IN3O |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 1-[2-(3,5-dimethylphenyl)ethyl]-3-ethyl-2-[(1-hydroxycyclopentyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(O)CCCC1)NCCc1cc(C)cc(C)c1.I |
| InChI | InChI=1S/C19H31N3O.HI/c1-4-20-18(22-14-19(23)8-5-6-9-19)21-10-7-17-12-15(2)11-16(3)13-17;/h11-13,23H,4-10,14H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | WNQQULLAJGOPHE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|