C16H33IN4O3 — CID 111999128
tert-butyl N-[2-[[N-ethyl-N'-[(1-hydroxycyclopentyl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111999128) has the molecular formula C16H33IN4O3 and a molecular weight of 456.37 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-[(1-hydroxycyclopentyl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-[(1-hydroxycyclopentyl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111999128 |
| Molecular Formula | C16H33IN4O3 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-[(1-hydroxycyclopentyl)methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CC1(O)CCCC1)NCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C16H32N4O3.HI/c1-5-17-13(20-12-16(22)8-6-7-9-16)18-10-11-19-14(21)23-15(2,3)4;/h22H,5-12H2,1-4H3,(H,19,21)(H2,17,18,20);1H |
| InChIKey | CUCKWRGTQACVAM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|