C20H22F2N4O — CID 111989161
2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[2-(3-fluorophenoxy)propyl]guanidine (PubChem CID 111989161) has the molecular formula C20H22F2N4O and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[2-(3-fluorophenoxy)propyl]guanidine.
| Compound Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[2-(3-fluorophenoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111989161 |
| Molecular Formula | C20H22F2N4O |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[(5-cyano-2-fluorophenyl)methyl]-1-ethyl-3-[2-(3-fluorophenoxy)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(C#N)ccc1F)NCC(C)Oc1cccc(F)c1 |
| InChI | InChI=1S/C20H22F2N4O/c1-3-24-20(26-13-16-9-15(11-23)7-8-19(16)22)25-12-14(2)27-18-6-4-5-17(21)10-18/h4-10,14H,3,12-13H2,1-2H3,(H2,24,25,26) |
| InChIKey | RQLGRUHEBWRNPS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|