C22H28N2O2 — CID 11198972
N-cyclohexyl-2-(4-methylphenyl)-2-[(1R,6S)-8-oxo-7-azabicyclo[4.2.0]oct-3-en-7-yl]acetamide (PubChem CID 11198972) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-cyclohexyl-2-(4-methylphenyl)-2-[(1R,6S)-8-oxo-7-azabicyclo[4.2.0]oct-3-en-7-yl]acetamide.
| Compound Name | N-cyclohexyl-2-(4-methylphenyl)-2-[(1R,6S)-8-oxo-7-azabicyclo[4.2.0]oct-3-en-7-yl]acetamide |
|---|---|
| PubChem CID | 11198972 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-cyclohexyl-2-(4-methylphenyl)-2-[(1R,6S)-8-oxo-7-azabicyclo[4.2.0]oct-3-en-7-yl]acetamide |
| SMILES | Cc1ccc(C(C(=O)NC2CCCCC2)N2C(=O)[C@@H]3CC=CC[C@@H]32)cc1 |
| InChI | InChI=1S/C22H28N2O2/c1-15-11-13-16(14-12-15)20(21(25)23-17-7-3-2-4-8-17)24-19-10-6-5-9-18(19)22(24)26/h5-6,11-14,17-20H,2-4,7-10H2,1H3,(H,23,25)/t18-,19+,20?/m1/s1 |
| InChIKey | YPPYCLLPQYIOPN-LFPSWIHMSA-N |
| XLogP | 3.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|