C24H32N2O2 — CID 11222739
N-cyclohexyl-2-[(1R,6S)-8-oxo-7-azabicyclo[4.2.0]oct-3-en-7-yl]-2-(4-propan-2-ylphenyl)acetamide (PubChem CID 11222739) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is N-cyclohexyl-2-[(1R,6S)-8-oxo-7-azabicyclo[4.2.0]oct-3-en-7-yl]-2-(4-propan-2-ylphenyl)acetamide.
| Compound Name | N-cyclohexyl-2-[(1R,6S)-8-oxo-7-azabicyclo[4.2.0]oct-3-en-7-yl]-2-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 11222739 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | N-cyclohexyl-2-[(1R,6S)-8-oxo-7-azabicyclo[4.2.0]oct-3-en-7-yl]-2-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(C(C(=O)NC2CCCCC2)N2C(=O)[C@@H]3CC=CC[C@@H]32)cc1 |
| InChI | InChI=1S/C24H32N2O2/c1-16(2)17-12-14-18(15-13-17)22(23(27)25-19-8-4-3-5-9-19)26-21-11-7-6-10-20(21)24(26)28/h6-7,12-16,19-22H,3-5,8-11H2,1-2H3,(H,25,27)/t20-,21+,22?/m1/s1 |
| InChIKey | MJEVJJGBVUETAK-LKXRKSRJSA-N |
| XLogP | 4.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|