C15H21F4N3O — CID 111990669
1-ethyl-2-[2-(4-fluorophenyl)-2-methoxyethyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111990669) has the molecular formula C15H21F4N3O and a molecular weight of 335.35 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-fluorophenyl)-2-methoxyethyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-methoxyethyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 111990669 |
| Molecular Formula | C15H21F4N3O |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-methoxyethyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CC(OC)c1ccc(F)cc1)NCCC(F)(F)F |
| InChI | InChI=1S/C15H21F4N3O/c1-3-20-14(21-9-8-15(17,18)19)22-10-13(23-2)11-4-6-12(16)7-5-11/h4-7,13H,3,8-10H2,1-2H3,(H2,20,21,22) |
| InChIKey | BOGTUWQMEHJQPU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|