C13H24F3N3 — CID 111992559
1-(4-ethylcyclohexyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111992559) has the molecular formula C13H24F3N3 and a molecular weight of 279.35 g/mol. Its IUPAC name is 1-(4-ethylcyclohexyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-(4-ethylcyclohexyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 111992559 |
| Molecular Formula | C13H24F3N3 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 1-(4-ethylcyclohexyl)-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCC1CCC(N/C(=N/C)NCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H24F3N3/c1-3-10-4-6-11(7-5-10)19-12(17-2)18-9-8-13(14,15)16/h10-11H,3-9H2,1-2H3,(H2,17,18,19) |
| InChIKey | AAXRQNWVKAHPCV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|