C18H28FN3O2 — CID 111995265
N-ethyl-N'-[2-(4-fluorophenoxy)propyl]-3-(methoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111995265) has the molecular formula C18H28FN3O2 and a molecular weight of 337.44 g/mol. Its IUPAC name is N-ethyl-N'-[2-(4-fluorophenoxy)propyl]-3-(methoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(4-fluorophenoxy)propyl]-3-(methoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111995265 |
| Molecular Formula | C18H28FN3O2 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | N-ethyl-N'-[2-(4-fluorophenoxy)propyl]-3-(methoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)Oc1ccc(F)cc1)N1CCC(COC)C1 |
| InChI | InChI=1S/C18H28FN3O2/c1-4-20-18(22-10-9-15(12-22)13-23-3)21-11-14(2)24-17-7-5-16(19)6-8-17/h5-8,14-15H,4,9-13H2,1-3H3,(H,20,21) |
| InChIKey | DRMDROZLUBNUIW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|