C19H15F3N2O3 — CID 11199721
2-(4,4-difluoro-1,3-dioxoisoquinolin-2-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide (PubChem CID 11199721) has the molecular formula C19H15F3N2O3 and a molecular weight of 376.33 g/mol. Its IUPAC name is 2-(4,4-difluoro-1,3-dioxoisoquinolin-2-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(4,4-difluoro-1,3-dioxoisoquinolin-2-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 11199721 |
| Molecular Formula | C19H15F3N2O3 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-(4,4-difluoro-1,3-dioxoisoquinolin-2-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C(F)(F)C1=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H15F3N2O3/c20-13-7-5-12(6-8-13)9-10-23-16(25)11-24-17(26)14-3-1-2-4-15(14)19(21,22)18(24)27/h1-8H,9-11H2,(H,23,25) |
| InChIKey | VXAXMNZBYCSPCP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|