C20H26F3N3O — CID 111997217
3-(ethoxymethyl)-N-ethyl-N'-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine-1-carboximidamide (PubChem CID 111997217) has the molecular formula C20H26F3N3O and a molecular weight of 381.44 g/mol. Its IUPAC name is 3-(ethoxymethyl)-N-ethyl-N'-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-(ethoxymethyl)-N-ethyl-N'-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111997217 |
| Molecular Formula | C20H26F3N3O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 3-(ethoxymethyl)-N-ethyl-N'-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC#Cc1cccc(C(F)(F)F)c1)N1CCC(COCC)C1 |
| InChI | InChI=1S/C20H26F3N3O/c1-3-24-19(26-12-10-17(14-26)15-27-4-2)25-11-6-8-16-7-5-9-18(13-16)20(21,22)23/h5,7,9,13,17H,3-4,10-12,14-15H2,1-2H3,(H,24,25) |
| InChIKey | OLOIUMYYWQVLGT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|