C21H24F3N5 — CID 111996003
N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine-1-carboximidamide (PubChem CID 111996003) has the molecular formula C21H24F3N5 and a molecular weight of 403.45 g/mol. Its IUPAC name is N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111996003 |
| Molecular Formula | C21H24F3N5 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-ethyl-3-(1-methylpyrazol-4-yl)-N'-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC#Cc1cccc(C(F)(F)F)c1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C21H24F3N5/c1-3-25-20(29-11-9-17(15-29)18-13-27-28(2)14-18)26-10-5-7-16-6-4-8-19(12-16)21(22,23)24/h4,6,8,12-14,17H,3,9-11,15H2,1-2H3,(H,25,26) |
| InChIKey | TXTKKCWILYMLGM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|