C19H22F3N5 — CID 111981979
3-ethyl-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-2-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine (PubChem CID 111981979) has the molecular formula C19H22F3N5 and a molecular weight of 377.41 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-2-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-2-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
|---|---|
| PubChem CID | 111981979 |
| Molecular Formula | C19H22F3N5 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(1-methylpyrazol-4-yl)methyl]-2-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
| SMILES | CCN/C(=N\CC#Cc1cccc(C(F)(F)F)c1)N(C)Cc1cnn(C)c1 |
| InChI | InChI=1S/C19H22F3N5/c1-4-23-18(26(2)13-16-12-25-27(3)14-16)24-10-6-8-15-7-5-9-17(11-15)19(20,21)22/h5,7,9,11-12,14H,4,10,13H2,1-3H3,(H,23,24) |
| InChIKey | DMTHOTDFMJSXNP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|