C20H30F3N3O2 — CID 111998269
1-ethyl-3-[(1-hydroxycyclohexyl)methyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111998269) has the molecular formula C20H30F3N3O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-ethyl-3-[(1-hydroxycyclohexyl)methyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[(1-hydroxycyclohexyl)methyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111998269 |
| Molecular Formula | C20H30F3N3O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 1-ethyl-3-[(1-hydroxycyclohexyl)methyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(COCC(F)(F)F)cc1)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C20H30F3N3O2/c1-2-24-18(26-14-19(27)10-4-3-5-11-19)25-12-16-6-8-17(9-7-16)13-28-15-20(21,22)23/h6-9,27H,2-5,10-15H2,1H3,(H2,24,25,26) |
| InChIKey | VGWQSPNARZEDDO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|