C20H39N5O — CID 111998479
N-[2-[[N-(1-cyclohexylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111998479) has the molecular formula C20H39N5O and a molecular weight of 365.57 g/mol. Its IUPAC name is N-[2-[[N-(1-cyclohexylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[N-(1-cyclohexylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111998479 |
| Molecular Formula | C20H39N5O |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.32 |
| IUPAC Name | N-[2-[[N-(1-cyclohexylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | C/N=C(\NCCNC(=O)C(C)(C)C)NC1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H39N5O/c1-20(2,3)18(26)22-12-13-23-19(21-4)24-16-10-14-25(15-11-16)17-8-6-5-7-9-17/h16-17H,5-15H2,1-4H3,(H,22,26)(H2,21,23,24) |
| InChIKey | OGYZAQLZRDNISJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|