C31H32N2O2 — CID 11202117
[2-ethyl-9-[(4-prop-1-en-2-ylcyclohexen-1-yl)methyl]pyrido[2,3-b]indol-3-yl]-(4-methoxyphenyl)methanone (PubChem CID 11202117) has the molecular formula C31H32N2O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is [2-ethyl-9-[(4-prop-1-en-2-ylcyclohexen-1-yl)methyl]pyrido[2,3-b]indol-3-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [2-ethyl-9-[(4-prop-1-en-2-ylcyclohexen-1-yl)methyl]pyrido[2,3-b]indol-3-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 11202117 |
| Molecular Formula | C31H32N2O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | [2-ethyl-9-[(4-prop-1-en-2-ylcyclohexen-1-yl)methyl]pyrido[2,3-b]indol-3-yl]-(4-methoxyphenyl)methanone |
| SMILES | C=C(C)C1CC=C(Cn2c3ccccc3c3cc(C(=O)c4ccc(OC)cc4)c(CC)nc32)CC1 |
| InChI | InChI=1S/C31H32N2O2/c1-5-28-27(30(34)23-14-16-24(35-4)17-15-23)18-26-25-8-6-7-9-29(25)33(31(26)32-28)19-21-10-12-22(13-11-21)20(2)3/h6-10,14-18,22H,2,5,11-13,19H2,1,3-4H3 |
| InChIKey | REFULHJOMHIBTB-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|