About [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate
[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate (PubChem CID 101152308) has the molecular formula C18H22O3
and a molecular weight of 286.37 g/mol. Its IUPAC name is [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate.
Molecular Properties
| Compound Name | [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate |
| PubChem CID | 101152308 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate |
| SMILES | C=C(C)[C@@H]1CC=C(COC(=O)c2ccccc2OC)CC1 |
| InChI | InChI=1S/C18H22O3/c1-13(2)15-10-8-14(9-11-15)12-21-18(19)16-6-4-5-7-17(16)20-3/h4-8,15H,1,9-12H2,2-3H3/t15-/m1/s1 |
| InChIKey | WPCNHZFKGYKGLX-OAHLLOKOSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate?
The IUPAC name of [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate (CID 101152308) is [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate.
What is the SMILES notation for [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate?
The canonical SMILES for [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate is C=C(C)[C@@H]1CC=C(COC(=O)c2ccccc2OC)CC1.
What is the InChIKey of [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate?
The InChIKey is WPCNHZFKGYKGLX-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H22O3/c1-13(2)15-10-8-14(9-11-15)12-21-18(19)16-6-4-5-7-17(16)20-3/h4-8,15H,1,9-12H2,2-3H3/t15-/m1/s1.
What are the key properties of [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate?
[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate has a molecular weight of 286.37 g/mol, XLogP of 4.15, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 2-methoxybenzoate is sourced from PubChem (CID 101152308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).