C34H39Cl3O4 — CID 157108843
4-chlorobenzoyl chloride;[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol;[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 4-chlorobenzoate (PubChem CID 157108843) has the molecular formula C34H39Cl3O4 and a molecular weight of 618.04 g/mol. Its IUPAC name is 4-chlorobenzoyl chloride;[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol;[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 4-chlorobenzoate.
| Compound Name | 4-chlorobenzoyl chloride;[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol;[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 157108843 |
| Molecular Formula | C34H39Cl3O4 |
| Molecular Weight | 618.04 g/mol |
| Exact Mass | 616.19 |
| IUPAC Name | 4-chlorobenzoyl chloride;[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol;[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl 4-chlorobenzoate |
| SMILES | C=C(C)[C@@H]1CC=C(CO)CC1.C=C(C)[C@@H]1CC=C(COC(=O)c2ccc(Cl)cc2)CC1.O=C(Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClO2.C10H16O.C7H4Cl2O/c1-12(2)14-5-3-13(4-6-14)11-20-17(19)15-7-9-16(18)10-8-15;1-8(2)10-5-3-9(7-11)4-6-10;8-6-3-1-5(2-4-6)7(9)10/h3,7-10,14H,1,4-6,11H2,2H3;3,10-11H,1,4-7H2,2H3;1-4H/t14-;10-;/m11./s1 |
| InChIKey | AGPNZKKOLCXWQT-NRQJTAIJSA-N |
| XLogP | 9.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.04 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|