C34H39N3O3 — CID 135060524
(E)-1-(4-methoxyphenyl)-3-[2-[(E)-1-morpholin-4-ylpropylideneamino]-1-(4-prop-1-en-2-ylcyclohexen-1-yl)indol-3-yl]prop-2-en-1-one (PubChem CID 135060524) has the molecular formula C34H39N3O3 and a molecular weight of 537.70 g/mol. Its IUPAC name is (E)-1-(4-methoxyphenyl)-3-[2-[(E)-1-morpholin-4-ylpropylideneamino]-1-(4-prop-1-en-2-ylcyclohexen-1-yl)indol-3-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-methoxyphenyl)-3-[2-[(E)-1-morpholin-4-ylpropylideneamino]-1-(4-prop-1-en-2-ylcyclohexen-1-yl)indol-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135060524 |
| Molecular Formula | C34H39N3O3 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | (E)-1-(4-methoxyphenyl)-3-[2-[(E)-1-morpholin-4-ylpropylideneamino]-1-(4-prop-1-en-2-ylcyclohexen-1-yl)indol-3-yl]prop-2-en-1-one |
| SMILES | C=C(C)C1CC=C(n2c(/N=C(\CC)N3CCOCC3)c(/C=C/C(=O)c3ccc(OC)cc3)c3ccccc32)CC1 |
| InChI | InChI=1S/C34H39N3O3/c1-5-33(36-20-22-40-23-21-36)35-34-30(18-19-32(38)26-12-16-28(39-4)17-13-26)29-8-6-7-9-31(29)37(34)27-14-10-25(11-15-27)24(2)3/h6-9,12-14,16-19,25H,2,5,10-11,15,20-23H2,1,3-4H3/b19-18+,35-33+ |
| InChIKey | CCMQXENNCSMMLA-HGAHKLOASA-N |
| XLogP | 7.54 |
| TPSA | 56.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|