C29H41F3N2O6Si — CID 11204167
tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-8,8,8-trifluoro-7-hydroxy-6-nitrooctan-2-yl]carbamate (PubChem CID 11204167) has the molecular formula C29H41F3N2O6Si and a molecular weight of 598.74 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-8,8,8-trifluoro-7-hydroxy-6-nitrooctan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-8,8,8-trifluoro-7-hydroxy-6-nitrooctan-2-yl]carbamate |
|---|---|
| PubChem CID | 11204167 |
| Molecular Formula | C29H41F3N2O6Si |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | tert-butyl N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-8,8,8-trifluoro-7-hydroxy-6-nitrooctan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCC(C(O)C(F)(F)F)[N+](=O)[O-])CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H41F3N2O6Si/c1-27(2,3)40-26(36)33-21(14-13-19-24(34(37)38)25(35)29(30,31)32)20-39-41(28(4,5)6,22-15-9-7-10-16-22)23-17-11-8-12-18-23/h7-12,15-18,21,24-25,35H,13-14,19-20H2,1-6H3,(H,33,36)/t21-,24?,25?/m0/s1 |
| InChIKey | GMDHHMHDGONZPH-ANYOXOOPSA-N |
| XLogP | 5.20 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|